C17H18F2N4O2 — CID 167819332
1-N'-(2,6-difluorophenyl)-1-N-[(1,3-dimethylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide (PubChem CID 167819332) has the molecular formula C17H18F2N4O2 and a molecular weight of 348.35 g/mol. Its IUPAC name is 1-N'-(2,6-difluorophenyl)-1-N-[(1,3-dimethylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2,6-difluorophenyl)-1-N-[(1,3-dimethylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 167819332 |
| Molecular Formula | C17H18F2N4O2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-N'-(2,6-difluorophenyl)-1-N-[(1,3-dimethylpyrazol-4-yl)methyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1nn(C)cc1CNC(=O)C1(C(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C17H18F2N4O2/c1-10-11(9-23(2)22-10)8-20-15(24)17(6-7-17)16(25)21-14-12(18)4-3-5-13(14)19/h3-5,9H,6-8H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | RGJPSBVNBVVHPC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|