C16H20FN3O2 — CID 167820299
3-[2-(4-fluoro-1H-indol-3-yl)ethyl]-1-(3-hydroxycyclobutyl)-1-methylurea (PubChem CID 167820299) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-[2-(4-fluoro-1H-indol-3-yl)ethyl]-1-(3-hydroxycyclobutyl)-1-methylurea.
| Compound Name | 3-[2-(4-fluoro-1H-indol-3-yl)ethyl]-1-(3-hydroxycyclobutyl)-1-methylurea |
|---|---|
| PubChem CID | 167820299 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-[2-(4-fluoro-1H-indol-3-yl)ethyl]-1-(3-hydroxycyclobutyl)-1-methylurea |
| SMILES | CN(C(=O)NCCc1c[nH]c2cccc(F)c12)C1CC(O)C1 |
| InChI | InChI=1S/C16H20FN3O2/c1-20(11-7-12(21)8-11)16(22)18-6-5-10-9-19-14-4-2-3-13(17)15(10)14/h2-4,9,11-12,19,21H,5-8H2,1H3,(H,18,22) |
| InChIKey | HLVOPKRHHKCSMI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |