C23H36N8O2 — CID 167823850
N'-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide (PubChem CID 167823850) has the molecular formula C23H36N8O2 and a molecular weight of 456.60 g/mol. Its IUPAC name is N'-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide.
| Compound Name | N'-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide |
|---|---|
| PubChem CID | 167823850 |
| Molecular Formula | C23H36N8O2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | N'-[1-[2-(diethylamino)ethyl]pyrazol-4-yl]-N-[3-(4-pyridin-4-ylpiperazin-1-yl)propyl]oxamide |
| SMILES | CCN(CC)CCn1cc(NC(=O)C(=O)NCCCN2CCN(c3ccncc3)CC2)cn1 |
| InChI | InChI=1S/C23H36N8O2/c1-3-28(4-2)14-17-31-19-20(18-26-31)27-23(33)22(32)25-8-5-11-29-12-15-30(16-13-29)21-6-9-24-10-7-21/h6-7,9-10,18-19H,3-5,8,11-17H2,1-2H3,(H,25,32)(H,27,33) |
| InChIKey | JVFHDYHZXHRYRS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|