C18H20N4O6 — CID 167827253
benzyl N-[3-[2-[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinyl]-3-oxopropyl]carbamate (PubChem CID 167827253) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is benzyl N-[3-[2-[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinyl]-3-oxopropyl]carbamate.
| Compound Name | benzyl N-[3-[2-[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinyl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 167827253 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | benzyl N-[3-[2-[2-(furan-2-ylmethylamino)-2-oxoacetyl]hydrazinyl]-3-oxopropyl]carbamate |
| SMILES | O=C(CCNC(=O)OCc1ccccc1)NNC(=O)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H20N4O6/c23-15(8-9-19-18(26)28-12-13-5-2-1-3-6-13)21-22-17(25)16(24)20-11-14-7-4-10-27-14/h1-7,10H,8-9,11-12H2,(H,19,26)(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | PMBWVEVOZFZGMF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|