C16H24O3S — CID 167831834
1-[1-(3,4-dimethylphenyl)ethylsulfonylmethyl]cyclopentan-1-ol (PubChem CID 167831834) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenyl)ethylsulfonylmethyl]cyclopentan-1-ol.
| Compound Name | 1-[1-(3,4-dimethylphenyl)ethylsulfonylmethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 167831834 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[1-(3,4-dimethylphenyl)ethylsulfonylmethyl]cyclopentan-1-ol |
| SMILES | Cc1ccc(C(C)S(=O)(=O)CC2(O)CCCC2)cc1C |
| InChI | InChI=1S/C16H24O3S/c1-12-6-7-15(10-13(12)2)14(3)20(18,19)11-16(17)8-4-5-9-16/h6-7,10,14,17H,4-5,8-9,11H2,1-3H3 |
| InChIKey | YVVGJDXTAGPINE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |