C16H14FN3O4S2 — CID 167832362
3-[[4-(dimethylamino)-1-benzothiophene-2-carbonyl]amino]-5-fluorosulfonyloxypyridine (PubChem CID 167832362) has the molecular formula C16H14FN3O4S2 and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)-1-benzothiophene-2-carbonyl]amino]-5-fluorosulfonyloxypyridine.
| Compound Name | 3-[[4-(dimethylamino)-1-benzothiophene-2-carbonyl]amino]-5-fluorosulfonyloxypyridine |
|---|---|
| PubChem CID | 167832362 |
| Molecular Formula | C16H14FN3O4S2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 3-[[4-(dimethylamino)-1-benzothiophene-2-carbonyl]amino]-5-fluorosulfonyloxypyridine |
| SMILES | CN(C)c1cccc2sc(C(=O)Nc3cncc(OS(=O)(=O)F)c3)cc12 |
| InChI | InChI=1S/C16H14FN3O4S2/c1-20(2)13-4-3-5-14-12(13)7-15(25-14)16(21)19-10-6-11(9-18-8-10)24-26(17,22)23/h3-9H,1-2H3,(H,19,21) |
| InChIKey | PSNHERSGOJOZSJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |