C18H21F2N3O2 — CID 167835617
7-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 167835617) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is 7-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 7-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 167835617 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 7-[1-[(2,6-difluorophenyl)methyl]piperidin-3-yl]-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC2(CCC2)C(=O)N1C1CCCN(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C18H21F2N3O2/c19-14-5-1-6-15(20)13(14)11-22-9-2-4-12(10-22)23-16(24)18(7-3-8-18)21-17(23)25/h1,5-6,12H,2-4,7-11H2,(H,21,25) |
| InChIKey | JLODSNLPWJJPKJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|