C15H16F3NO5 — CID 167836632
2-[4-[[(3R,4R)-3-(trifluoromethyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid (PubChem CID 167836632) has the molecular formula C15H16F3NO5 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2-[4-[[(3R,4R)-3-(trifluoromethyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[(3R,4R)-3-(trifluoromethyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 167836632 |
| Molecular Formula | C15H16F3NO5 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[4-[[(3R,4R)-3-(trifluoromethyl)oxan-4-yl]carbamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO5/c16-15(17,18)11-7-23-6-5-12(11)19-14(22)9-1-3-10(4-2-9)24-8-13(20)21/h1-4,11-12H,5-8H2,(H,19,22)(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | FYTSLDZVSMFXSP-NWDGAFQWSA-N |
| XLogP | 1.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |