C14H21BrN2O5S — CID 167838616
2-amino-5-bromo-3-[(2-methoxy-4-methylpentyl)sulfonylamino]benzoic acid (PubChem CID 167838616) has the molecular formula C14H21BrN2O5S and a molecular weight of 409.30 g/mol. Its IUPAC name is 2-amino-5-bromo-3-[(2-methoxy-4-methylpentyl)sulfonylamino]benzoic acid.
| Compound Name | 2-amino-5-bromo-3-[(2-methoxy-4-methylpentyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 167838616 |
| Molecular Formula | C14H21BrN2O5S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-amino-5-bromo-3-[(2-methoxy-4-methylpentyl)sulfonylamino]benzoic acid |
| SMILES | COC(CC(C)C)CS(=O)(=O)Nc1cc(Br)cc(C(=O)O)c1N |
| InChI | InChI=1S/C14H21BrN2O5S/c1-8(2)4-10(22-3)7-23(20,21)17-12-6-9(15)5-11(13(12)16)14(18)19/h5-6,8,10,17H,4,7,16H2,1-3H3,(H,18,19) |
| InChIKey | NJFHJQGRPRXNRP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|