C22H29NO3 — CID 167840098
2-quinolin-4-yloxyethyl 3,3,5,5-tetramethylcyclohexane-1-carboxylate (PubChem CID 167840098) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-quinolin-4-yloxyethyl 3,3,5,5-tetramethylcyclohexane-1-carboxylate.
| Compound Name | 2-quinolin-4-yloxyethyl 3,3,5,5-tetramethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167840098 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-quinolin-4-yloxyethyl 3,3,5,5-tetramethylcyclohexane-1-carboxylate |
| SMILES | CC1(C)CC(C(=O)OCCOc2ccnc3ccccc23)CC(C)(C)C1 |
| InChI | InChI=1S/C22H29NO3/c1-21(2)13-16(14-22(3,4)15-21)20(24)26-12-11-25-19-9-10-23-18-8-6-5-7-17(18)19/h5-10,16H,11-15H2,1-4H3 |
| InChIKey | MXOUYWNOSHZKCK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|