C20H20ClN5O4S — CID 167844669
3-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)-5-(tetrazolidin-5-yl)benzenesulfonamide (PubChem CID 167844669) has the molecular formula C20H20ClN5O4S and a molecular weight of 461.93 g/mol. Its IUPAC name is 3-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)-5-(tetrazolidin-5-yl)benzenesulfonamide.
| Compound Name | 3-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)-5-(tetrazolidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 167844669 |
| Molecular Formula | C20H20ClN5O4S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 3-chloro-2-hydroxy-N-(2-methoxy-5-phenylphenyl)-5-(tetrazolidin-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(-c2ccccc2)cc1NS(=O)(=O)c1cc(C2NNNN2)cc(Cl)c1O |
| InChI | InChI=1S/C20H20ClN5O4S/c1-30-17-8-7-13(12-5-3-2-4-6-12)10-16(17)24-31(28,29)18-11-14(9-15(21)19(18)27)20-22-25-26-23-20/h2-11,20,22-27H,1H3 |
| InChIKey | JVJBSSNZTAQYIY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |