C18H15F2N3O2 — CID 167845210
N-(2,4-difluorophenyl)-1-ethyl-5-oxo-3-phenyl-4H-pyrazole-4-carboxamide (PubChem CID 167845210) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-1-ethyl-5-oxo-3-phenyl-4H-pyrazole-4-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-1-ethyl-5-oxo-3-phenyl-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167845210 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-1-ethyl-5-oxo-3-phenyl-4H-pyrazole-4-carboxamide |
| SMILES | CCN1N=C(c2ccccc2)C(C(=O)Nc2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C18H15F2N3O2/c1-2-23-18(25)15(16(22-23)11-6-4-3-5-7-11)17(24)21-14-9-8-12(19)10-13(14)20/h3-10,15H,2H2,1H3,(H,21,24) |
| InChIKey | GNWILICVOQFZJD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|