C15H9F2NO2S — CID 13037182
N-(2,4-difluorophenyl)-2-oxo-3H-1-benzothiophene-3-carboxamide (PubChem CID 13037182) has the molecular formula C15H9F2NO2S and a molecular weight of 305.31 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-oxo-3H-1-benzothiophene-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-2-oxo-3H-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 13037182 |
| Molecular Formula | C15H9F2NO2S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-oxo-3H-1-benzothiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1C(=O)Sc2ccccc21 |
| InChI | InChI=1S/C15H9F2NO2S/c16-8-5-6-11(10(17)7-8)18-14(19)13-9-3-1-2-4-12(9)21-15(13)20/h1-7,13H,(H,18,19) |
| InChIKey | VVORKHYOLSMZMW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|