About 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate
2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate (PubChem CID 167848247) has the molecular formula C22H17N3O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate |
| PubChem CID | 167848247 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate |
| SMILES | O=C(OCCc1cccc2ncccc12)c1cccc(-c2ccncc2)n1 |
| InChI | InChI=1S/C22H17N3O2/c26-22(21-8-2-6-19(25-21)17-9-13-23-14-10-17)27-15-11-16-4-1-7-20-18(16)5-3-12-24-20/h1-10,12-14H,11,15H2 |
| InChIKey | DYNIDUZZJYJLII-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate?
The IUPAC name of 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate (CID 167848247) is 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate.
What is the SMILES notation for 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate?
The canonical SMILES for 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate is O=C(OCCc1cccc2ncccc12)c1cccc(-c2ccncc2)n1.
What is the InChIKey of 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate?
The InChIKey is DYNIDUZZJYJLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O2/c26-22(21-8-2-6-19(25-21)17-9-13-23-14-10-17)27-15-11-16-4-1-7-20-18(16)5-3-12-24-20/h1-10,12-14H,11,15H2.
What are the key properties of 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate?
2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate has a molecular weight of 355.40 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-5-ylethyl 6-pyridin-4-ylpyridine-2-carboxylate is sourced from PubChem (CID 167848247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).