C18H15N5O2S — CID 167849022
N-(6-hydroxy-1H-indazol-3-yl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide (PubChem CID 167849022) has the molecular formula C18H15N5O2S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-(6-hydroxy-1H-indazol-3-yl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide.
| Compound Name | N-(6-hydroxy-1H-indazol-3-yl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 167849022 |
| Molecular Formula | C18H15N5O2S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(6-hydroxy-1H-indazol-3-yl)-2-methylsulfanyl-3-phenylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2n[nH]c3cc(O)ccc23)n1-c1ccccc1 |
| InChI | InChI=1S/C18H15N5O2S/c1-26-18-19-10-15(23(18)11-5-3-2-4-6-11)17(25)20-16-13-8-7-12(24)9-14(13)21-22-16/h2-10,24H,1H3,(H2,20,21,22,25) |
| InChIKey | AFLSJYRZYHWZEQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |