C17H14N6O2 — CID 167983807
N-(6-hydroxy-1H-indazol-3-yl)-1-(3-methylphenyl)triazole-4-carboxamide (PubChem CID 167983807) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is N-(6-hydroxy-1H-indazol-3-yl)-1-(3-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-(6-hydroxy-1H-indazol-3-yl)-1-(3-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 167983807 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-(6-hydroxy-1H-indazol-3-yl)-1-(3-methylphenyl)triazole-4-carboxamide |
| SMILES | Cc1cccc(-n2cc(C(=O)Nc3n[nH]c4cc(O)ccc34)nn2)c1 |
| InChI | InChI=1S/C17H14N6O2/c1-10-3-2-4-11(7-10)23-9-15(20-22-23)17(25)18-16-13-6-5-12(24)8-14(13)19-21-16/h2-9,24H,1H3,(H2,18,19,21,25) |
| InChIKey | AGNXLDPDJPPUMW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |