C8H8N4O2 — CID 174460689
(6-hydroxy-1H-indazol-3-yl)urea (PubChem CID 174460689) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is (6-hydroxy-1H-indazol-3-yl)urea.
| Compound Name | (6-hydroxy-1H-indazol-3-yl)urea |
|---|---|
| PubChem CID | 174460689 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (6-hydroxy-1H-indazol-3-yl)urea |
| SMILES | NC(=O)Nc1n[nH]c2cc(O)ccc12 |
| InChI | InChI=1S/C8H8N4O2/c9-8(14)10-7-5-2-1-4(13)3-6(5)11-12-7/h1-3,13H,(H4,9,10,11,12,14) |
| InChIKey | YTXCCPQFQAESBL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |