C13H12FN5O2 — CID 167930386
1-(2-fluoroethyl)-N-(6-hydroxy-1H-indazol-3-yl)pyrazole-4-carboxamide (PubChem CID 167930386) has the molecular formula C13H12FN5O2 and a molecular weight of 289.27 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N-(6-hydroxy-1H-indazol-3-yl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-fluoroethyl)-N-(6-hydroxy-1H-indazol-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167930386 |
| Molecular Formula | C13H12FN5O2 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(2-fluoroethyl)-N-(6-hydroxy-1H-indazol-3-yl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1n[nH]c2cc(O)ccc12)c1cnn(CCF)c1 |
| InChI | InChI=1S/C13H12FN5O2/c14-3-4-19-7-8(6-15-19)13(21)16-12-10-2-1-9(20)5-11(10)17-18-12/h1-2,5-7,20H,3-4H2,(H2,16,17,18,21) |
| InChIKey | NPJRHCPHTSYTJE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |