C19H18FNO3 — CID 167855076
[1-[(4-fluorophenyl)methyl]cyclopropyl] (E)-3-(5-methoxy-3-pyridinyl)prop-2-enoate (PubChem CID 167855076) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is [1-[(4-fluorophenyl)methyl]cyclopropyl] (E)-3-(5-methoxy-3-pyridinyl)prop-2-enoate.
| Compound Name | [1-[(4-fluorophenyl)methyl]cyclopropyl] (E)-3-(5-methoxy-3-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 167855076 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [1-[(4-fluorophenyl)methyl]cyclopropyl] (E)-3-(5-methoxy-3-pyridinyl)prop-2-enoate |
| SMILES | COc1cncc(/C=C/C(=O)OC2(Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C19H18FNO3/c1-23-17-10-15(12-21-13-17)4-7-18(22)24-19(8-9-19)11-14-2-5-16(20)6-3-14/h2-7,10,12-13H,8-9,11H2,1H3/b7-4+ |
| InChIKey | OAXISGPYPKQALI-QPJJXVBHSA-N |
| XLogP | 3.56 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|