C16H23F2NO2S — CID 167858346
N-[(2,2-difluorocyclohexyl)methyl]-4-(2-methylsulfonylethyl)aniline (PubChem CID 167858346) has the molecular formula C16H23F2NO2S and a molecular weight of 331.43 g/mol. Its IUPAC name is N-[(2,2-difluorocyclohexyl)methyl]-4-(2-methylsulfonylethyl)aniline.
| Compound Name | N-[(2,2-difluorocyclohexyl)methyl]-4-(2-methylsulfonylethyl)aniline |
|---|---|
| PubChem CID | 167858346 |
| Molecular Formula | C16H23F2NO2S |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[(2,2-difluorocyclohexyl)methyl]-4-(2-methylsulfonylethyl)aniline |
| SMILES | CS(=O)(=O)CCc1ccc(NCC2CCCCC2(F)F)cc1 |
| InChI | InChI=1S/C16H23F2NO2S/c1-22(20,21)11-9-13-5-7-15(8-6-13)19-12-14-4-2-3-10-16(14,17)18/h5-8,14,19H,2-4,9-12H2,1H3 |
| InChIKey | SCEQOMYQZWEFCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |