C15H17N7O2 — CID 167860443
N-[1-(1H-benzimidazol-2-yl)azetidin-3-yl]-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 167860443) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)azetidin-3-yl]-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)azetidin-3-yl]-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 167860443 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)azetidin-3-yl]-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(NC2CN(c3nc4ccccc4[nH]3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N7O2/c1-9-13(22(23)24)14(20(2)19-9)16-10-7-21(8-10)15-17-11-5-3-4-6-12(11)18-15/h3-6,10,16H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | MPWVTIWOTDWHTC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|