C15H20N4O2 — CID 167860658
(E)-2-cyano-3-[2-(oxan-4-yl)pyrazol-3-yl]-N-propylprop-2-enamide (PubChem CID 167860658) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-(oxan-4-yl)pyrazol-3-yl]-N-propylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-(oxan-4-yl)pyrazol-3-yl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 167860658 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (E)-2-cyano-3-[2-(oxan-4-yl)pyrazol-3-yl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C/c1ccnn1C1CCOCC1 |
| InChI | InChI=1S/C15H20N4O2/c1-2-6-17-15(20)12(11-16)10-14-3-7-18-19(14)13-4-8-21-9-5-13/h3,7,10,13H,2,4-6,8-9H2,1H3,(H,17,20)/b12-10+ |
| InChIKey | NCHCHSRQBFHUPA-ZRDIBKRKSA-N |
| XLogP | 1.67 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|