C16H18N2O3 — CID 178201524
(E)-2-cyano-3-[4-(1,3-dioxolan-2-yl)phenyl]-N-propylprop-2-enamide (PubChem CID 178201524) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(1,3-dioxolan-2-yl)phenyl]-N-propylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(1,3-dioxolan-2-yl)phenyl]-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 178201524 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (E)-2-cyano-3-[4-(1,3-dioxolan-2-yl)phenyl]-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C/c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-7-18-15(19)14(11-17)10-12-3-5-13(6-4-12)16-20-8-9-21-16/h3-6,10,16H,2,7-9H2,1H3,(H,18,19)/b14-10+ |
| InChIKey | KCDKJIJTBAEVAX-GXDHUFHOSA-N |
| XLogP | 2.17 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|