C13H15N3O2 — CID 167952642
(E)-2-cyano-3-(3-cyclopropyl-1,2-oxazol-4-yl)-N-propylprop-2-enamide (PubChem CID 167952642) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is (E)-2-cyano-3-(3-cyclopropyl-1,2-oxazol-4-yl)-N-propylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3-cyclopropyl-1,2-oxazol-4-yl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 167952642 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (E)-2-cyano-3-(3-cyclopropyl-1,2-oxazol-4-yl)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C/c1conc1C1CC1 |
| InChI | InChI=1S/C13H15N3O2/c1-2-5-15-13(17)10(7-14)6-11-8-18-16-12(11)9-3-4-9/h6,8-9H,2-5H2,1H3,(H,15,17)/b10-6+ |
| InChIKey | SLNLBIRLKOOQHL-UXBLZVDNSA-N |
| XLogP | 1.99 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|