C12H15N3O2 — CID 136555988
2-cyano-3-(2,4-dimethyl-1,3-oxazol-5-yl)-N-propylprop-2-enamide (PubChem CID 136555988) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-cyano-3-(2,4-dimethyl-1,3-oxazol-5-yl)-N-propylprop-2-enamide.
| Compound Name | 2-cyano-3-(2,4-dimethyl-1,3-oxazol-5-yl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 136555988 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-cyano-3-(2,4-dimethyl-1,3-oxazol-5-yl)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)C(C#N)=Cc1oc(C)nc1C |
| InChI | InChI=1S/C12H15N3O2/c1-4-5-14-12(16)10(7-13)6-11-8(2)15-9(3)17-11/h6H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | QANLREGDVIXUFH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|