C19H19FO5 — CID 167863131
4-[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybenzoic acid (PubChem CID 167863131) has the molecular formula C19H19FO5 and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybenzoic acid.
| Compound Name | 4-[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167863131 |
| Molecular Formula | C19H19FO5 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[5-fluoro-2-(oxolan-2-ylmethoxy)phenyl]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1-c1cc(F)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C19H19FO5/c1-23-18-9-12(19(21)22)4-6-15(18)16-10-13(20)5-7-17(16)25-11-14-3-2-8-24-14/h4-7,9-10,14H,2-3,8,11H2,1H3,(H,21,22) |
| InChIKey | GTAMMASWBDOSGB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |