C23H35N5O2 — CID 167864026
N-(1-adamantylmethyl)-N-methyl-2-[2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]acetamide (PubChem CID 167864026) has the molecular formula C23H35N5O2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-methyl-2-[2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]acetamide.
| Compound Name | N-(1-adamantylmethyl)-N-methyl-2-[2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 167864026 |
| Molecular Formula | C23H35N5O2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | N-(1-adamantylmethyl)-N-methyl-2-[2-[(pyridazin-3-ylamino)methyl]morpholin-4-yl]acetamide |
| SMILES | CN(CC12CC3CC(CC(C3)C1)C2)C(=O)CN1CCOC(CNc2cccnn2)C1 |
| InChI | InChI=1S/C23H35N5O2/c1-27(16-23-10-17-7-18(11-23)9-19(8-17)12-23)22(29)15-28-5-6-30-20(14-28)13-24-21-3-2-4-25-26-21/h2-4,17-20H,5-16H2,1H3,(H,24,26) |
| InChIKey | UQLOEACXBGYIJE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |