C12H20N4O3S — CID 71872271
N-[[4-(2-methylsulfonylethyl)morpholin-2-yl]methyl]pyridazin-3-amine (PubChem CID 71872271) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[[4-(2-methylsulfonylethyl)morpholin-2-yl]methyl]pyridazin-3-amine.
| Compound Name | N-[[4-(2-methylsulfonylethyl)morpholin-2-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 71872271 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[[4-(2-methylsulfonylethyl)morpholin-2-yl]methyl]pyridazin-3-amine |
| SMILES | CS(=O)(=O)CCN1CCOC(CNc2cccnn2)C1 |
| InChI | InChI=1S/C12H20N4O3S/c1-20(17,18)8-6-16-5-7-19-11(10-16)9-13-12-3-2-4-14-15-12/h2-4,11H,5-10H2,1H3,(H,13,15) |
| InChIKey | WPRPEXMJRKKLLZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |