C17H29N5O — CID 71872217
N-[[4-[2-(cyclohexylamino)ethyl]morpholin-2-yl]methyl]pyridazin-3-amine (PubChem CID 71872217) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[[4-[2-(cyclohexylamino)ethyl]morpholin-2-yl]methyl]pyridazin-3-amine.
| Compound Name | N-[[4-[2-(cyclohexylamino)ethyl]morpholin-2-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 71872217 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N-[[4-[2-(cyclohexylamino)ethyl]morpholin-2-yl]methyl]pyridazin-3-amine |
| SMILES | c1cnnc(NCC2CN(CCNC3CCCCC3)CCO2)c1 |
| InChI | InChI=1S/C17H29N5O/c1-2-5-15(6-3-1)18-9-10-22-11-12-23-16(14-22)13-19-17-7-4-8-20-21-17/h4,7-8,15-16,18H,1-3,5-6,9-14H2,(H,19,21) |
| InChIKey | WZAHKNPXKSXDBN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |