C14H17ClN4OS — CID 71928020
N-[[4-[(5-chlorothiophen-2-yl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine (PubChem CID 71928020) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is N-[[4-[(5-chlorothiophen-2-yl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine.
| Compound Name | N-[[4-[(5-chlorothiophen-2-yl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 71928020 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-[[4-[(5-chlorothiophen-2-yl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine |
| SMILES | Clc1ccc(CN2CCOC(CNc3cccnn3)C2)s1 |
| InChI | InChI=1S/C14H17ClN4OS/c15-13-4-3-12(21-13)10-19-6-7-20-11(9-19)8-16-14-2-1-5-17-18-14/h1-5,11H,6-10H2,(H,16,18) |
| InChIKey | PEQZFROKINFNPM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |