C17H21ClN4O2 — CID 71928027
N-[[4-[(5-chloro-2-methoxyphenyl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine (PubChem CID 71928027) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[[4-[(5-chloro-2-methoxyphenyl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine.
| Compound Name | N-[[4-[(5-chloro-2-methoxyphenyl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 71928027 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[[4-[(5-chloro-2-methoxyphenyl)methyl]morpholin-2-yl]methyl]pyridazin-3-amine |
| SMILES | COc1ccc(Cl)cc1CN1CCOC(CNc2cccnn2)C1 |
| InChI | InChI=1S/C17H21ClN4O2/c1-23-16-5-4-14(18)9-13(16)11-22-7-8-24-15(12-22)10-19-17-3-2-6-20-21-17/h2-6,9,15H,7-8,10-12H2,1H3,(H,19,21) |
| InChIKey | GZBRJMNRTXQOSC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |