C15H20N4OS — CID 96512563
N-[[(2R)-4-(2-thiophen-2-ylethyl)morpholin-2-yl]methyl]pyridazin-3-amine (PubChem CID 96512563) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[[(2R)-4-(2-thiophen-2-ylethyl)morpholin-2-yl]methyl]pyridazin-3-amine.
| Compound Name | N-[[(2R)-4-(2-thiophen-2-ylethyl)morpholin-2-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 96512563 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[[(2R)-4-(2-thiophen-2-ylethyl)morpholin-2-yl]methyl]pyridazin-3-amine |
| SMILES | c1cnnc(NC[C@@H]2CN(CCc3cccs3)CCO2)c1 |
| InChI | InChI=1S/C15H20N4OS/c1-4-15(18-17-6-1)16-11-13-12-19(8-9-20-13)7-5-14-3-2-10-21-14/h1-4,6,10,13H,5,7-9,11-12H2,(H,16,18)/t13-/m1/s1 |
| InChIKey | CAVCKYKDQFKXRZ-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |