C14H17N7O — CID 167864911
8-(6-imidazol-1-ylpyridazin-3-yl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 167864911) has the molecular formula C14H17N7O and a molecular weight of 299.34 g/mol. Its IUPAC name is 8-(6-imidazol-1-ylpyridazin-3-yl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 8-(6-imidazol-1-ylpyridazin-3-yl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 167864911 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 8-(6-imidazol-1-ylpyridazin-3-yl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1NCC2(CCN(c3ccc(-n4ccnc4)nn3)CC2)N1 |
| InChI | InChI=1S/C14H17N7O/c22-13-16-9-14(17-13)3-6-20(7-4-14)11-1-2-12(19-18-11)21-8-5-15-10-21/h1-2,5,8,10H,3-4,6-7,9H2,(H2,16,17,22) |
| InChIKey | LKGKHEPPFDSMHI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |