C22H23ClFN3O — CID 167865232
7-[[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]amino]methyl]-1H-quinolin-4-one (PubChem CID 167865232) has the molecular formula C22H23ClFN3O and a molecular weight of 399.90 g/mol. Its IUPAC name is 7-[[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]amino]methyl]-1H-quinolin-4-one.
| Compound Name | 7-[[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]amino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 167865232 |
| Molecular Formula | C22H23ClFN3O |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 7-[[[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]amino]methyl]-1H-quinolin-4-one |
| SMILES | O=c1cc[nH]c2cc(CNC3CCN(Cc4c(F)cccc4Cl)CC3)ccc12 |
| InChI | InChI=1S/C22H23ClFN3O/c23-19-2-1-3-20(24)18(19)14-27-10-7-16(8-11-27)26-13-15-4-5-17-21(12-15)25-9-6-22(17)28/h1-6,9,12,16,26H,7-8,10-11,13-14H2,(H,25,28) |
| InChIKey | NDDGDJCZNYBHCE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |