C11H18N2O4S2 — CID 167875514
3-[2-[(3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 167875514) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-[2-[(3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167875514 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-[2-[(3-ethyl-4,5-dihydro-1,2-oxazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | CCC1=NOC(C(=O)NCCSSCCC(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-2-8-7-9(17-13-8)11(16)12-4-6-19-18-5-3-10(14)15/h9H,2-7H2,1H3,(H,12,16)(H,14,15) |
| InChIKey | BBIULRJKDZIARX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|