C13H23NO4S2 — CID 166424964
3-[2-[[2-(3,3-dimethyloxolan-2-yl)acetyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166424964) has the molecular formula C13H23NO4S2 and a molecular weight of 321.46 g/mol. Its IUPAC name is 3-[2-[[2-(3,3-dimethyloxolan-2-yl)acetyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-(3,3-dimethyloxolan-2-yl)acetyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166424964 |
| Molecular Formula | C13H23NO4S2 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[2-[[2-(3,3-dimethyloxolan-2-yl)acetyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC1(C)CCOC1CC(=O)NCCSSCCC(=O)O |
| InChI | InChI=1S/C13H23NO4S2/c1-13(2)4-6-18-10(13)9-11(15)14-5-8-20-19-7-3-12(16)17/h10H,3-9H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | UWDKAPWIVDFXJF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|