C12H21NO4S2 — CID 166422421
3-[2-[(1-methoxycyclopentanecarbonyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422421) has the molecular formula C12H21NO4S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-[2-[(1-methoxycyclopentanecarbonyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(1-methoxycyclopentanecarbonyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422421 |
| Molecular Formula | C12H21NO4S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[2-[(1-methoxycyclopentanecarbonyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | COC1(C(=O)NCCSSCCC(=O)O)CCCC1 |
| InChI | InChI=1S/C12H21NO4S2/c1-17-12(5-2-3-6-12)11(16)13-7-9-19-18-8-4-10(14)15/h2-9H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | ITXQUNQPPUKIBW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|