C15H25NO4S2 — CID 167922779
3-[2-[[2-[(2S,6R)-6-cyclopropyloxan-2-yl]acetyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 167922779) has the molecular formula C15H25NO4S2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 3-[2-[[2-[(2S,6R)-6-cyclopropyloxan-2-yl]acetyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-[(2S,6R)-6-cyclopropyloxan-2-yl]acetyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167922779 |
| Molecular Formula | C15H25NO4S2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 3-[2-[[2-[(2S,6R)-6-cyclopropyloxan-2-yl]acetyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)C[C@@H]1CCC[C@H](C2CC2)O1 |
| InChI | InChI=1S/C15H25NO4S2/c17-14(16-7-9-22-21-8-6-15(18)19)10-12-2-1-3-13(20-12)11-4-5-11/h11-13H,1-10H2,(H,16,17)(H,18,19)/t12-,13+/m0/s1 |
| InChIKey | BLTKAKZRXFIIIW-QWHCGFSZSA-N |
| XLogP | 2.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|