C14H14FIN4 — CID 167881010
4-fluoro-1-[(3-iodoimidazo[1,2-a]pyridin-8-yl)methyl]piperidine-4-carbonitrile (PubChem CID 167881010) has the molecular formula C14H14FIN4 and a molecular weight of 384.20 g/mol. Its IUPAC name is 4-fluoro-1-[(3-iodoimidazo[1,2-a]pyridin-8-yl)methyl]piperidine-4-carbonitrile.
| Compound Name | 4-fluoro-1-[(3-iodoimidazo[1,2-a]pyridin-8-yl)methyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 167881010 |
| Molecular Formula | C14H14FIN4 |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 4-fluoro-1-[(3-iodoimidazo[1,2-a]pyridin-8-yl)methyl]piperidine-4-carbonitrile |
| SMILES | N#CC1(F)CCN(Cc2cccn3c(I)cnc23)CC1 |
| InChI | InChI=1S/C14H14FIN4/c15-14(10-17)3-6-19(7-4-14)9-11-2-1-5-20-12(16)8-18-13(11)20/h1-2,5,8H,3-4,6-7,9H2 |
| InChIKey | IDPJKLJOUZUOAH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|