C20H20N4O — CID 167882908
(4-aminoquinazolin-7-yl)-(3-ethyl-3-phenylazetidin-1-yl)methanone (PubChem CID 167882908) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (4-aminoquinazolin-7-yl)-(3-ethyl-3-phenylazetidin-1-yl)methanone.
| Compound Name | (4-aminoquinazolin-7-yl)-(3-ethyl-3-phenylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 167882908 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4-aminoquinazolin-7-yl)-(3-ethyl-3-phenylazetidin-1-yl)methanone |
| SMILES | CCC1(c2ccccc2)CN(C(=O)c2ccc3c(N)ncnc3c2)C1 |
| InChI | InChI=1S/C20H20N4O/c1-2-20(15-6-4-3-5-7-15)11-24(12-20)19(25)14-8-9-16-17(10-14)22-13-23-18(16)21/h3-10,13H,2,11-12H2,1H3,(H2,21,22,23) |
| InChIKey | SGURHOPWOQAVPP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |