C22H28N2O5 — CID 167888687
tert-butyl N-[[2-[1-(2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]phenyl]methyl]carbamate (PubChem CID 167888687) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl N-[[2-[1-(2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[1-(2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 167888687 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl N-[[2-[1-(2-hydroxy-5-methoxyphenyl)ethylcarbamoyl]phenyl]methyl]carbamate |
| SMILES | COc1ccc(O)c(C(C)NC(=O)c2ccccc2CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H28N2O5/c1-14(18-12-16(28-5)10-11-19(18)25)24-20(26)17-9-7-6-8-15(17)13-23-21(27)29-22(2,3)4/h6-12,14,25H,13H2,1-5H3,(H,23,27)(H,24,26) |
| InChIKey | PEGKVJYGXGWPSW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|