C20H32N2O2S — CID 167892083
N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-(2-phenylethyl)piperidin-4-amine (PubChem CID 167892083) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-(2-phenylethyl)piperidin-4-amine.
| Compound Name | N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-(2-phenylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 167892083 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[(1R,2R)-2-methylsulfonylcyclohexyl]-1-(2-phenylethyl)piperidin-4-amine |
| SMILES | CS(=O)(=O)[C@@H]1CCCC[C@H]1NC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H32N2O2S/c1-25(23,24)20-10-6-5-9-19(20)21-18-12-15-22(16-13-18)14-11-17-7-3-2-4-8-17/h2-4,7-8,18-21H,5-6,9-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | VJKFMHFLHDBCSQ-WOJBJXKFSA-N |
| XLogP | 2.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |