C19H20F3NO3 — CID 167893759
3-[4-(hydroxymethyl)phenyl]-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]propanamide (PubChem CID 167893759) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)phenyl]-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]propanamide.
| Compound Name | 3-[4-(hydroxymethyl)phenyl]-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 167893759 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-[4-(hydroxymethyl)phenyl]-N-[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]propanamide |
| SMILES | O=C(CCc1ccc(CO)cc1)NC(CO)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3NO3/c20-19(21,22)16-8-6-15(7-9-16)17(12-25)23-18(26)10-5-13-1-3-14(11-24)4-2-13/h1-4,6-9,17,24-25H,5,10-12H2,(H,23,26) |
| InChIKey | GQVQUXDSNDWORE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |