C17H16ClN3O4S — CID 167904573
6-[(6-chloro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)sulfonyl]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one (PubChem CID 167904573) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is 6-[(6-chloro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)sulfonyl]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-[(6-chloro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)sulfonyl]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 167904573 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 6-[(6-chloro-2-oxo-3,4-dihydro-1H-quinolin-7-yl)sulfonyl]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(Cl)c(S(=O)(=O)N3CCc4[nH]c(=O)ccc4C3)cc2N1 |
| InChI | InChI=1S/C17H16ClN3O4S/c18-12-7-10-1-3-17(23)20-14(10)8-15(12)26(24,25)21-6-5-13-11(9-21)2-4-16(22)19-13/h2,4,7-8H,1,3,5-6,9H2,(H,19,22)(H,20,23) |
| InChIKey | OBOAETDDPIVMOW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |