About (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate
(3-acetamidophenyl)methyl 4-indol-1-ylbenzoate (PubChem CID 167905028) has the molecular formula C24H20N2O3
and a molecular weight of 384.44 g/mol. Its IUPAC name is (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate.
Molecular Properties
| Compound Name | (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate |
| PubChem CID | 167905028 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate |
| SMILES | CC(=O)Nc1cccc(COC(=O)c2ccc(-n3ccc4ccccc43)cc2)c1 |
| InChI | InChI=1S/C24H20N2O3/c1-17(27)25-21-7-4-5-18(15-21)16-29-24(28)20-9-11-22(12-10-20)26-14-13-19-6-2-3-8-23(19)26/h2-15H,16H2,1H3,(H,25,27) |
| InChIKey | DLHPORNHEWBOHB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate?
The IUPAC name of (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate (CID 167905028) is (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate.
What is the SMILES notation for (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate?
The canonical SMILES for (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate is CC(=O)Nc1cccc(COC(=O)c2ccc(-n3ccc4ccccc43)cc2)c1.
What is the InChIKey of (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate?
The InChIKey is DLHPORNHEWBOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O3/c1-17(27)25-21-7-4-5-18(15-21)16-29-24(28)20-9-11-22(12-10-20)26-14-13-19-6-2-3-8-23(19)26/h2-15H,16H2,1H3,(H,25,27).
What are the key properties of (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate?
(3-acetamidophenyl)methyl 4-indol-1-ylbenzoate has a molecular weight of 384.44 g/mol, XLogP of 4.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamidophenyl)methyl 4-indol-1-ylbenzoate is sourced from PubChem (CID 167905028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).