C20H23F3N4O — CID 167906083
(3S,4R)-4-phenyl-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl]methyl]pyrrolidine-3-carboxamide (PubChem CID 167906083) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-phenyl-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 167906083 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (3S,4R)-4-phenyl-1-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl]methyl]pyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CN(Cc2c(C(F)(F)F)nc3n2CCCC3)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H23F3N4O/c21-20(22,23)18-16(27-9-5-4-8-17(27)25-18)12-26-10-14(15(11-26)19(24)28)13-6-2-1-3-7-13/h1-3,6-7,14-15H,4-5,8-12H2,(H2,24,28)/t14-,15+/m0/s1 |
| InChIKey | HHTBQPCLBBEYDG-LSDHHAIUSA-N |
| XLogP | 2.94 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |