C20H17N3O5S — CID 167909594
4-(2-oxo-1,3-oxazolidin-3-yl)-N-(5-phenoxy-2-pyridinyl)benzenesulfonamide (PubChem CID 167909594) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-(2-oxo-1,3-oxazolidin-3-yl)-N-(5-phenoxy-2-pyridinyl)benzenesulfonamide.
| Compound Name | 4-(2-oxo-1,3-oxazolidin-3-yl)-N-(5-phenoxy-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167909594 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-(2-oxo-1,3-oxazolidin-3-yl)-N-(5-phenoxy-2-pyridinyl)benzenesulfonamide |
| SMILES | O=C1OCCN1c1ccc(S(=O)(=O)Nc2ccc(Oc3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C20H17N3O5S/c24-20-23(12-13-27-20)15-6-9-18(10-7-15)29(25,26)22-19-11-8-17(14-21-19)28-16-4-2-1-3-5-16/h1-11,14H,12-13H2,(H,21,22) |
| InChIKey | GLKSUYYDBOPYAV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |