C12H14N2O3 — CID 167914324
(1R,3S,4S,6R)-3-hydroxy-N-(5-methyl-1,3-oxazol-2-yl)tricyclo[2.2.1.02,6]heptane-1-carboxamide (PubChem CID 167914324) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1R,3S,4S,6R)-3-hydroxy-N-(5-methyl-1,3-oxazol-2-yl)tricyclo[2.2.1.02,6]heptane-1-carboxamide.
| Compound Name | (1R,3S,4S,6R)-3-hydroxy-N-(5-methyl-1,3-oxazol-2-yl)tricyclo[2.2.1.02,6]heptane-1-carboxamide |
|---|---|
| PubChem CID | 167914324 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (1R,3S,4S,6R)-3-hydroxy-N-(5-methyl-1,3-oxazol-2-yl)tricyclo[2.2.1.02,6]heptane-1-carboxamide |
| SMILES | Cc1cnc(NC(=O)[C@]23C[C@@H]4C[C@@H]2C3C4O)o1 |
| InChI | InChI=1S/C12H14N2O3/c1-5-4-13-11(17-5)14-10(16)12-3-6-2-7(12)8(12)9(6)15/h4,6-9,15H,2-3H2,1H3,(H,13,14,16)/t6-,7+,8?,9?,12+/m0/s1 |
| InChIKey | YKVCJHNBMQRVCV-PMILTDCNSA-N |
| XLogP | 0.94 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |