C8H10N2O2S — CID 131234501
(E)-N-(5-methyl-1,3-oxazol-2-yl)-3-methylsulfanylprop-2-enamide (PubChem CID 131234501) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is (E)-N-(5-methyl-1,3-oxazol-2-yl)-3-methylsulfanylprop-2-enamide.
| Compound Name | (E)-N-(5-methyl-1,3-oxazol-2-yl)-3-methylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 131234501 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (E)-N-(5-methyl-1,3-oxazol-2-yl)-3-methylsulfanylprop-2-enamide |
| SMILES | CS/C=C/C(=O)Nc1ncc(C)o1 |
| InChI | InChI=1S/C8H10N2O2S/c1-6-5-9-8(12-6)10-7(11)3-4-13-2/h3-5H,1-2H3,(H,9,10,11)/b4-3+ |
| InChIKey | FOGFRPZEXFFSRI-ONEGZZNKSA-N |
| XLogP | 1.80 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|