C19H18N4O3 — CID 167920541
N-[4-(3-methylphenoxy)phenyl]-N'-(5-methyl-1H-pyrazol-4-yl)oxamide (PubChem CID 167920541) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[4-(3-methylphenoxy)phenyl]-N'-(5-methyl-1H-pyrazol-4-yl)oxamide.
| Compound Name | N-[4-(3-methylphenoxy)phenyl]-N'-(5-methyl-1H-pyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 167920541 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[4-(3-methylphenoxy)phenyl]-N'-(5-methyl-1H-pyrazol-4-yl)oxamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)C(=O)Nc3cn[nH]c3C)cc2)c1 |
| InChI | InChI=1S/C19H18N4O3/c1-12-4-3-5-16(10-12)26-15-8-6-14(7-9-15)21-18(24)19(25)22-17-11-20-23-13(17)2/h3-11H,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | PHPLEICHBLJVOM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|